C17H18N4O3 — CID 120684145
(4aR,7aS)-1-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 120684145) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is (4aR,7aS)-1-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aS)-1-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 120684145 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (4aR,7aS)-1-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NC[C@@H]2[C@H]1CCCN2C(=O)c1nn(-c2ccccc2)cc1O |
| InChI | InChI=1S/C17H18N4O3/c22-14-10-21(11-5-2-1-3-6-11)19-15(14)17(24)20-8-4-7-12-13(20)9-18-16(12)23/h1-3,5-6,10,12-13,22H,4,7-9H2,(H,18,23)/t12-,13-/m1/s1 |
| InChIKey | DNBJJZHBOOGWTB-CHWSQXEVSA-N |
| XLogP | 0.93 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |