C17H20N4O2 — CID 120684212
2-[[(4aR,7aS)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]methyl]-3-methylquinazolin-4-one (PubChem CID 120684212) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[[(4aR,7aS)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]methyl]-3-methylquinazolin-4-one.
| Compound Name | 2-[[(4aR,7aS)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]methyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 120684212 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[[(4aR,7aS)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]methyl]-3-methylquinazolin-4-one |
| SMILES | Cn1c(CN2CCC[C@H]3C(=O)NC[C@H]32)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H20N4O2/c1-20-15(19-13-7-3-2-5-11(13)17(20)23)10-21-8-4-6-12-14(21)9-18-16(12)22/h2-3,5,7,12,14H,4,6,8-10H2,1H3,(H,18,22)/t12-,14-/m1/s1 |
| InChIKey | LNWAUKDELCSVEE-TZMCWYRMSA-N |
| XLogP | 0.64 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |