C12H14ClNO3S — CID 120684484
2-[(4-chloro-2-ethylsulfanylbenzoyl)-methylamino]acetic acid (PubChem CID 120684484) has the molecular formula C12H14ClNO3S and a molecular weight of 287.77 g/mol. Its IUPAC name is 2-[(4-chloro-2-ethylsulfanylbenzoyl)-methylamino]acetic acid.
| Compound Name | 2-[(4-chloro-2-ethylsulfanylbenzoyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 120684484 |
| Molecular Formula | C12H14ClNO3S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-[(4-chloro-2-ethylsulfanylbenzoyl)-methylamino]acetic acid |
| SMILES | CCSc1cc(Cl)ccc1C(=O)N(C)CC(=O)O |
| InChI | InChI=1S/C12H14ClNO3S/c1-3-18-10-6-8(13)4-5-9(10)12(17)14(2)7-11(15)16/h4-6H,3,7H2,1-2H3,(H,15,16) |
| InChIKey | SCZZVFWPOKPQLK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |