C15H23Br2ClO — CID 12068481
(2R,3R,4R,4aR,6S,7S)-3,6-dibromo-7-chloro-1,4,4a,7-tetramethyl-3,4,5,6,8,9-hexahydro-2H-benzo[7]annulen-2-ol (PubChem CID 12068481) has the molecular formula C15H23Br2ClO and a molecular weight of 414.61 g/mol. Its IUPAC name is (2R,3R,4R,4aR,6S,7S)-3,6-dibromo-7-chloro-1,4,4a,7-tetramethyl-3,4,5,6,8,9-hexahydro-2H-benzo[7]annulen-2-ol.
| Compound Name | (2R,3R,4R,4aR,6S,7S)-3,6-dibromo-7-chloro-1,4,4a,7-tetramethyl-3,4,5,6,8,9-hexahydro-2H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 12068481 |
| Molecular Formula | C15H23Br2ClO |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | (2R,3R,4R,4aR,6S,7S)-3,6-dibromo-7-chloro-1,4,4a,7-tetramethyl-3,4,5,6,8,9-hexahydro-2H-benzo[7]annulen-2-ol |
| SMILES | CC1=C2CC[C@](C)(Cl)[C@@H](Br)C[C@]2(C)[C@@H](C)[C@@H](Br)[C@@H]1O |
| InChI | InChI=1S/C15H23Br2ClO/c1-8-10-5-6-15(4,18)11(16)7-14(10,3)9(2)12(17)13(8)19/h9,11-13,19H,5-7H2,1-4H3/t9-,11-,12+,13+,14+,15-/m0/s1 |
| InChIKey | YLAQAFYQJBFDON-MAMMZNRUSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|