C15H21N3O3 — CID 120685018
5-(3-cyclohexylpropylcarbamoyl)pyrazine-2-carboxylic acid (PubChem CID 120685018) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-(3-cyclohexylpropylcarbamoyl)pyrazine-2-carboxylic acid.
| Compound Name | 5-(3-cyclohexylpropylcarbamoyl)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120685018 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-(3-cyclohexylpropylcarbamoyl)pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(=O)NCCCC2CCCCC2)cn1 |
| InChI | InChI=1S/C15H21N3O3/c19-14(12-9-18-13(10-17-12)15(20)21)16-8-4-7-11-5-2-1-3-6-11/h9-11H,1-8H2,(H,16,19)(H,20,21) |
| InChIKey | RHGAIGSODIWIDI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|