C18H19N3O4 — CID 120685365
5-[[1-(4-methoxyphenyl)cyclopentyl]carbamoyl]pyrazine-2-carboxylic acid (PubChem CID 120685365) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-[[1-(4-methoxyphenyl)cyclopentyl]carbamoyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[1-(4-methoxyphenyl)cyclopentyl]carbamoyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120685365 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-[[1-(4-methoxyphenyl)cyclopentyl]carbamoyl]pyrazine-2-carboxylic acid |
| SMILES | COc1ccc(C2(NC(=O)c3cnc(C(=O)O)cn3)CCCC2)cc1 |
| InChI | InChI=1S/C18H19N3O4/c1-25-13-6-4-12(5-7-13)18(8-2-3-9-18)21-16(22)14-10-20-15(11-19-14)17(23)24/h4-7,10-11H,2-3,8-9H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | VECRIAQGYODRFP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |