C22H27NO4 — CID 120687688
2-[[2-(4-methoxyphenyl)butanoylamino]methyl]-3-(3-methylphenyl)propanoic acid (PubChem CID 120687688) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)butanoylamino]methyl]-3-(3-methylphenyl)propanoic acid.
| Compound Name | 2-[[2-(4-methoxyphenyl)butanoylamino]methyl]-3-(3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 120687688 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)butanoylamino]methyl]-3-(3-methylphenyl)propanoic acid |
| SMILES | CCC(C(=O)NCC(Cc1cccc(C)c1)C(=O)O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-4-20(17-8-10-19(27-3)11-9-17)21(24)23-14-18(22(25)26)13-16-7-5-6-15(2)12-16/h5-12,18,20H,4,13-14H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | QXDGCPPZJJLTPU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |