C15H20FNO3 — CID 120688320
4-fluoro-3-(2,2,4-trimethylpentanoylamino)benzoic acid (PubChem CID 120688320) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-fluoro-3-(2,2,4-trimethylpentanoylamino)benzoic acid.
| Compound Name | 4-fluoro-3-(2,2,4-trimethylpentanoylamino)benzoic acid |
|---|---|
| PubChem CID | 120688320 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-fluoro-3-(2,2,4-trimethylpentanoylamino)benzoic acid |
| SMILES | CC(C)CC(C)(C)C(=O)Nc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C15H20FNO3/c1-9(2)8-15(3,4)14(20)17-12-7-10(13(18)19)5-6-11(12)16/h5-7,9H,8H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | KNWYNJXSTPGMPO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |