C16H27NO3 — CID 120688808
2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid (PubChem CID 120688808) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid.
| Compound Name | 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 120688808 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid |
| SMILES | C=C(C)CC(C)C(=O)NC1CCCCCCC1C(=O)O |
| InChI | InChI=1S/C16H27NO3/c1-11(2)10-12(3)15(18)17-14-9-7-5-4-6-8-13(14)16(19)20/h12-14H,1,4-10H2,2-3H3,(H,17,18)(H,19,20) |
| InChIKey | CVXYLTANZNLPEW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|