2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid

C16H27NO3 — CID 120688808

IUPAC2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid
SMILESC=C(C)CC(C)C(=O)NC1CCCCCCC1C(=O)O
InChIInChI=1S/C16H27NO3/c1-11(2)10-12(3)15(18)17-14-9-7-5-4-6-8-13(14)16(19)20/h12-14H,1,4-10H2,2-3H3,(H,17,18)(H,19,20)
InChIKeyCVXYLTANZNLPEW-UHFFFAOYSA-N
MW281.40 g/mol
LogP3.13
Rot. Bonds5

About 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid

2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid (PubChem CID 120688808) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid.

Molecular Properties

Compound Name2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid
PubChem CID120688808
Molecular FormulaC16H27NO3
Molecular Weight281.40 g/mol
Exact Mass281.20
IUPAC Name2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid
SMILESC=C(C)CC(C)C(=O)NC1CCCCCCC1C(=O)O
InChIInChI=1S/C16H27NO3/c1-11(2)10-12(3)15(18)17-14-9-7-5-4-6-8-13(14)16(19)20/h12-14H,1,4-10H2,2-3H3,(H,17,18)(H,19,20)
InChIKeyCVXYLTANZNLPEW-UHFFFAOYSA-N
XLogP3.13
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.40
LogP ≤ 53.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid?
The IUPAC name of 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid (CID 120688808) is 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid.
What is the SMILES notation for 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid?
The canonical SMILES for 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid is C=C(C)CC(C)C(=O)NC1CCCCCCC1C(=O)O.
What is the InChIKey of 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid?
The InChIKey is CVXYLTANZNLPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO3/c1-11(2)10-12(3)15(18)17-14-9-7-5-4-6-8-13(14)16(19)20/h12-14H,1,4-10H2,2-3H3,(H,17,18)(H,19,20).
What are the key properties of 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid?
2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid has a molecular weight of 281.40 g/mol, XLogP of 3.13, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylpent-4-enoylamino)cyclooctane-1-carboxylic acid is sourced from PubChem (CID 120688808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).