C17H17N3O4 — CID 120689077
5-[3-(2-methoxyphenyl)pyrrolidine-1-carbonyl]pyrazine-2-carboxylic acid (PubChem CID 120689077) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-[3-(2-methoxyphenyl)pyrrolidine-1-carbonyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[3-(2-methoxyphenyl)pyrrolidine-1-carbonyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120689077 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 5-[3-(2-methoxyphenyl)pyrrolidine-1-carbonyl]pyrazine-2-carboxylic acid |
| SMILES | COc1ccccc1C1CCN(C(=O)c2cnc(C(=O)O)cn2)C1 |
| InChI | InChI=1S/C17H17N3O4/c1-24-15-5-3-2-4-12(15)11-6-7-20(10-11)16(21)13-8-19-14(9-18-13)17(22)23/h2-5,8-9,11H,6-7,10H2,1H3,(H,22,23) |
| InChIKey | PUSHCXFFZBTJMS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |