C30H36N2O2 — CID 12068929
(1S,12S,13S,14S)-16-benzyl-13-(1,3-dioxolan-2-yl)-3-methyl-14-[(3R)-pent-1-en-3-yl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene (PubChem CID 12068929) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is (1S,12S,13S,14S)-16-benzyl-13-(1,3-dioxolan-2-yl)-3-methyl-14-[(3R)-pent-1-en-3-yl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene.
| Compound Name | (1S,12S,13S,14S)-16-benzyl-13-(1,3-dioxolan-2-yl)-3-methyl-14-[(3R)-pent-1-en-3-yl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 12068929 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | (1S,12S,13S,14S)-16-benzyl-13-(1,3-dioxolan-2-yl)-3-methyl-14-[(3R)-pent-1-en-3-yl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene |
| SMILES | C=C[C@@H](CC)[C@@H]1C[C@H]2c3c(c4ccccc4n3C)C[C@@H]([C@H]1C1OCCO1)N2Cc1ccccc1 |
| InChI | InChI=1S/C30H36N2O2/c1-4-21(5-2)23-17-27-29-24(22-13-9-10-14-25(22)31(29)3)18-26(28(23)30-33-15-16-34-30)32(27)19-20-11-7-6-8-12-20/h4,6-14,21,23,26-28,30H,1,5,15-19H2,2-3H3/t21-,23-,26-,27-,28-/m0/s1 |
| InChIKey | QCFYAVIVPYTTQA-MJKWQMTMSA-N |
| XLogP | 5.87 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|