C17H21NO6 — CID 120689588
(6R)-4-[4-(4-methoxyphenyl)-4-oxobutanoyl]-6-methylmorpholine-2-carboxylic acid (PubChem CID 120689588) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is (6R)-4-[4-(4-methoxyphenyl)-4-oxobutanoyl]-6-methylmorpholine-2-carboxylic acid.
| Compound Name | (6R)-4-[4-(4-methoxyphenyl)-4-oxobutanoyl]-6-methylmorpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 120689588 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (6R)-4-[4-(4-methoxyphenyl)-4-oxobutanoyl]-6-methylmorpholine-2-carboxylic acid |
| SMILES | COc1ccc(C(=O)CCC(=O)N2CC(C(=O)O)O[C@H](C)C2)cc1 |
| InChI | InChI=1S/C17H21NO6/c1-11-9-18(10-15(24-11)17(21)22)16(20)8-7-14(19)12-3-5-13(23-2)6-4-12/h3-6,11,15H,7-10H2,1-2H3,(H,21,22)/t11-,15?/m1/s1 |
| InChIKey | SATMFSYKMSJXJT-ZRKZCGFPSA-N |
| XLogP | 1.36 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |