C18H20BrNO4 — CID 120689675
3-[1-(5-bromo-7-methyl-1-benzofuran-2-carbonyl)piperidin-2-yl]propanoic acid (PubChem CID 120689675) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is 3-[1-(5-bromo-7-methyl-1-benzofuran-2-carbonyl)piperidin-2-yl]propanoic acid.
| Compound Name | 3-[1-(5-bromo-7-methyl-1-benzofuran-2-carbonyl)piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 120689675 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3-[1-(5-bromo-7-methyl-1-benzofuran-2-carbonyl)piperidin-2-yl]propanoic acid |
| SMILES | Cc1cc(Br)cc2cc(C(=O)N3CCCCC3CCC(=O)O)oc12 |
| InChI | InChI=1S/C18H20BrNO4/c1-11-8-13(19)9-12-10-15(24-17(11)12)18(23)20-7-3-2-4-14(20)5-6-16(21)22/h8-10,14H,2-7H2,1H3,(H,21,22) |
| InChIKey | QXLXOQOLEKZYCN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |