About trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate
trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate (PubChem CID 12068984) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate |
| PubChem CID | 12068984 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCC[C@H]1N1CCNCC1 |
| InChI | InChI=1S/C15H28N2O2/c1-15(2,3)19-14(18)12-6-4-5-7-13(12)17-10-8-16-9-11-17/h12-13,16H,4-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | OQOJODXLKJJXAQ-CHWSQXEVSA-N |
| XLogP | 1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate?
The IUPAC name of trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate (CID 12068984) is trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate.
What is the SMILES notation for trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate?
The canonical SMILES for trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate is CC(C)(C)OC(=O)[C@@H]1CCCC[C@H]1N1CCNCC1.
What is the InChIKey of trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate?
The InChIKey is OQOJODXLKJJXAQ-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H28N2O2/c1-15(2,3)19-14(18)12-6-4-5-7-13(12)17-10-8-16-9-11-17/h12-13,16H,4-11H2,1-3H3/t12-,13-/m1/s1.
What are the key properties of trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate?
trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate has a molecular weight of 268.40 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-tert-butyl (1R,2R)-2-piperazin-1-ylcyclohexane-1-carboxylate is sourced from PubChem (CID 12068984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).