C20H27NO5 — CID 120689969
2-[2-(2,4-dimethylpent-4-enoyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]acetic acid (PubChem CID 120689969) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylpent-4-enoyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]acetic acid.
| Compound Name | 2-[2-(2,4-dimethylpent-4-enoyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]acetic acid |
|---|---|
| PubChem CID | 120689969 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-[2-(2,4-dimethylpent-4-enoyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]acetic acid |
| SMILES | C=C(C)CC(C)C(=O)N1CCc2cc(OC)c(OC)cc2C1CC(=O)O |
| InChI | InChI=1S/C20H27NO5/c1-12(2)8-13(3)20(24)21-7-6-14-9-17(25-4)18(26-5)10-15(14)16(21)11-19(22)23/h9-10,13,16H,1,6-8,11H2,2-5H3,(H,22,23) |
| InChIKey | YJTCASQRPBGQTB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|