C22H27NO4 — CID 120690192
4-[2-(4-methoxyphenyl)butanoylamino]-5-phenylpentanoic acid (PubChem CID 120690192) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)butanoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[2-(4-methoxyphenyl)butanoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120690192 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)butanoylamino]-5-phenylpentanoic acid |
| SMILES | CCC(C(=O)NC(CCC(=O)O)Cc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-3-20(17-9-12-19(27-2)13-10-17)22(26)23-18(11-14-21(24)25)15-16-7-5-4-6-8-16/h4-10,12-13,18,20H,3,11,14-15H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | ZWDGNYVOPYTJDO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |