C16H25NO5 — CID 120690422
(3aS,7aS)-2-[2-(oxan-4-yl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120690422) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3aS,7aS)-2-[2-(oxan-4-yl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[2-(oxan-4-yl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120690422 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (3aS,7aS)-2-[2-(oxan-4-yl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | CC(C(=O)N1C[C@H]2COCC[C@@]2(C(=O)O)C1)C1CCOCC1 |
| InChI | InChI=1S/C16H25NO5/c1-11(12-2-5-21-6-3-12)14(18)17-8-13-9-22-7-4-16(13,10-17)15(19)20/h11-13H,2-10H2,1H3,(H,19,20)/t11?,13-,16+/m0/s1 |
| InChIKey | IPJQLPXKLOCZQZ-GRLMSTMOSA-N |
| XLogP | 1.00 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |