C18H18N4O6 — CID 120690463
(3aS,7aS)-2-[1-(2-nitrophenyl)pyrazole-3-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120690463) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is (3aS,7aS)-2-[1-(2-nitrophenyl)pyrazole-3-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[1-(2-nitrophenyl)pyrazole-3-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120690463 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (3aS,7aS)-2-[1-(2-nitrophenyl)pyrazole-3-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(c1ccn(-c2ccccc2[N+](=O)[O-])n1)N1C[C@H]2COCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C18H18N4O6/c23-16(20-9-12-10-28-8-6-18(12,11-20)17(24)25)13-5-7-21(19-13)14-3-1-2-4-15(14)22(26)27/h1-5,7,12H,6,8-11H2,(H,24,25)/t12-,18+/m0/s1 |
| InChIKey | LZWATNOXCIHDTE-KPZWWZAWSA-N |
| XLogP | 1.34 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|