C25H46O2Si — CID 12069143
(3R,4R,4aS,8aS)-3,4,8a-trimethyl-8-methylidene-4-[2-tri(propan-2-yl)silyloxyethyl]-2,3,4a,5,6,7-hexahydronaphthalen-1-one (PubChem CID 12069143) has the molecular formula C25H46O2Si and a molecular weight of 406.73 g/mol. Its IUPAC name is (3R,4R,4aS,8aS)-3,4,8a-trimethyl-8-methylidene-4-[2-tri(propan-2-yl)silyloxyethyl]-2,3,4a,5,6,7-hexahydronaphthalen-1-one.
| Compound Name | (3R,4R,4aS,8aS)-3,4,8a-trimethyl-8-methylidene-4-[2-tri(propan-2-yl)silyloxyethyl]-2,3,4a,5,6,7-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 12069143 |
| Molecular Formula | C25H46O2Si |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (3R,4R,4aS,8aS)-3,4,8a-trimethyl-8-methylidene-4-[2-tri(propan-2-yl)silyloxyethyl]-2,3,4a,5,6,7-hexahydronaphthalen-1-one |
| SMILES | C=C1CCC[C@@H]2[C@]1(C)C(=O)C[C@@H](C)[C@@]2(C)CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H46O2Si/c1-17(2)28(18(3)4,19(5)6)27-15-14-24(9)21(8)16-23(26)25(10)20(7)12-11-13-22(24)25/h17-19,21-22H,7,11-16H2,1-6,8-10H3/t21-,22+,24-,25-/m1/s1 |
| InChIKey | XKFNFXLOGCTXMF-PEISPCAHSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|