C18H23N3O6 — CID 120691825
3-[4-(butylcarbamoyl)piperidine-1-carbonyl]-5-nitrobenzoic acid (PubChem CID 120691825) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is 3-[4-(butylcarbamoyl)piperidine-1-carbonyl]-5-nitrobenzoic acid.
| Compound Name | 3-[4-(butylcarbamoyl)piperidine-1-carbonyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 120691825 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-[4-(butylcarbamoyl)piperidine-1-carbonyl]-5-nitrobenzoic acid |
| SMILES | CCCCNC(=O)C1CCN(C(=O)c2cc(C(=O)O)cc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H23N3O6/c1-2-3-6-19-16(22)12-4-7-20(8-5-12)17(23)13-9-14(18(24)25)11-15(10-13)21(26)27/h9-12H,2-8H2,1H3,(H,19,22)(H,24,25) |
| InChIKey | VWWWKIPKGGWMHE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|