About (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid
(E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid (PubChem CID 120692958) has the molecular formula C17H19F2NO3
and a molecular weight of 323.34 g/mol. Its IUPAC name is (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid.
Molecular Properties
| Compound Name | (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid |
| PubChem CID | 120692958 |
| Molecular Formula | C17H19F2NO3 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)C1(c2ccc(F)cc2F)CCC1)C(=O)O |
| InChI | InChI=1S/C17H19F2NO3/c1-2-3-5-14(15(21)22)20-16(23)17(8-4-9-17)12-7-6-11(18)10-13(12)19/h2-3,6-7,10,14H,4-5,8-9H2,1H3,(H,20,23)(H,21,22)/b3-2+ |
| InChIKey | KBBHYONSGWFKIP-NSCUHMNNSA-N |
| XLogP | 2.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid?
The IUPAC name of (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid (CID 120692958) is (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid.
What is the SMILES notation for (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid?
The canonical SMILES for (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid is C/C=C/CC(NC(=O)C1(c2ccc(F)cc2F)CCC1)C(=O)O.
What is the InChIKey of (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid?
The InChIKey is KBBHYONSGWFKIP-NSCUHMNNSA-N. The full InChI is InChI=1S/C17H19F2NO3/c1-2-3-5-14(15(21)22)20-16(23)17(8-4-9-17)12-7-6-11(18)10-13(12)19/h2-3,6-7,10,14H,4-5,8-9H2,1H3,(H,20,23)(H,21,22)/b3-2+.
What are the key properties of (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid?
(E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid has a molecular weight of 323.34 g/mol, XLogP of 2.92, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[[1-(2,4-difluorophenyl)cyclobutanecarbonyl]amino]hex-4-enoic acid is sourced from PubChem (CID 120692958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).