C16H19NO4 — CID 120693025
(E)-2-(3,4-dihydro-2H-chromene-4-carbonylamino)hex-4-enoic acid (PubChem CID 120693025) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (E)-2-(3,4-dihydro-2H-chromene-4-carbonylamino)hex-4-enoic acid.
| Compound Name | (E)-2-(3,4-dihydro-2H-chromene-4-carbonylamino)hex-4-enoic acid |
|---|---|
| PubChem CID | 120693025 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (E)-2-(3,4-dihydro-2H-chromene-4-carbonylamino)hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)C1CCOc2ccccc21)C(=O)O |
| InChI | InChI=1S/C16H19NO4/c1-2-3-7-13(16(19)20)17-15(18)12-9-10-21-14-8-5-4-6-11(12)14/h2-6,8,12-13H,7,9-10H2,1H3,(H,17,18)(H,19,20)/b3-2+ |
| InChIKey | AMFOPINOURRPHC-NSCUHMNNSA-N |
| XLogP | 2.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|