C19H24N2O5 — CID 120693126
(E)-2-[[1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]hex-4-enoic acid (PubChem CID 120693126) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is (E)-2-[[1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693126 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (E)-2-[[1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)C1CC(=O)N(c2cc(C)ccc2OC)C1)C(=O)O |
| InChI | InChI=1S/C19H24N2O5/c1-4-5-6-14(19(24)25)20-18(23)13-10-17(22)21(11-13)15-9-12(2)7-8-16(15)26-3/h4-5,7-9,13-14H,6,10-11H2,1-3H3,(H,20,23)(H,24,25)/b5-4+ |
| InChIKey | MUKOHMHDXZPDSV-SNAWJCMRSA-N |
| XLogP | 1.89 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|