About (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid
(E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid (PubChem CID 120693244) has the molecular formula C19H23N3O3
and a molecular weight of 341.41 g/mol. Its IUPAC name is (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid.
Molecular Properties
| Compound Name | (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid |
| PubChem CID | 120693244 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc(C)n(-c2cc(C)cc(C)c2)n1)C(=O)O |
| InChI | InChI=1S/C19H23N3O3/c1-5-6-7-16(19(24)25)20-18(23)17-11-14(4)22(21-17)15-9-12(2)8-13(3)10-15/h5-6,8-11,16H,7H2,1-4H3,(H,20,23)(H,24,25)/b6-5+ |
| InChIKey | BSKYPTGSBCAKJX-AATRIKPKSA-N |
| XLogP | 2.95 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid?
The IUPAC name of (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid (CID 120693244) is (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid.
What is the SMILES notation for (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid?
The canonical SMILES for (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid is C/C=C/CC(NC(=O)c1cc(C)n(-c2cc(C)cc(C)c2)n1)C(=O)O.
What is the InChIKey of (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid?
The InChIKey is BSKYPTGSBCAKJX-AATRIKPKSA-N. The full InChI is InChI=1S/C19H23N3O3/c1-5-6-7-16(19(24)25)20-18(23)17-11-14(4)22(21-17)15-9-12(2)8-13(3)10-15/h5-6,8-11,16H,7H2,1-4H3,(H,20,23)(H,24,25)/b6-5+.
What are the key properties of (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid?
(E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid has a molecular weight of 341.41 g/mol, XLogP of 2.95, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[[1-(3,5-dimethylphenyl)-5-methylpyrazole-3-carbonyl]amino]hex-4-enoic acid is sourced from PubChem (CID 120693244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).