C21H28N2O5 — CID 120693343
(E)-2-[[1-(3-phenoxypropanoyl)piperidine-4-carbonyl]amino]hex-4-enoic acid (PubChem CID 120693343) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is (E)-2-[[1-(3-phenoxypropanoyl)piperidine-4-carbonyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[1-(3-phenoxypropanoyl)piperidine-4-carbonyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693343 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (E)-2-[[1-(3-phenoxypropanoyl)piperidine-4-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)C1CCN(C(=O)CCOc2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C21H28N2O5/c1-2-3-9-18(21(26)27)22-20(25)16-10-13-23(14-11-16)19(24)12-15-28-17-7-5-4-6-8-17/h2-8,16,18H,9-15H2,1H3,(H,22,25)(H,26,27)/b3-2+ |
| InChIKey | MSZQDOJEEARGJE-NSCUHMNNSA-N |
| XLogP | 2.23 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|