C16H15ClFNO6S2 — CID 12069367
9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylic acid (PubChem CID 12069367) has the molecular formula C16H15ClFNO6S2 and a molecular weight of 435.88 g/mol. Its IUPAC name is 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylic acid.
| Compound Name | 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 12069367 |
| Molecular Formula | C16H15ClFNO6S2 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2c(F)cccc2Cl)C2=C(CS(=O)(=O)CCS2(=O)=O)N1 |
| InChI | InChI=1S/C16H15ClFNO6S2/c1-8-12(16(20)21)14(13-9(17)3-2-4-10(13)18)15-11(19-8)7-26(22,23)5-6-27(15,24)25/h2-4,14,19H,5-7H2,1H3,(H,20,21) |
| InChIKey | BATINJAUZFJREI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |