C18H17ClFNO8S2 — CID 12069369
2-[9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carbonyl]oxyacetic acid (PubChem CID 12069369) has the molecular formula C18H17ClFNO8S2 and a molecular weight of 493.92 g/mol. Its IUPAC name is 2-[9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carbonyl]oxyacetic acid.
| Compound Name | 2-[9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carbonyl]oxyacetic acid |
|---|---|
| PubChem CID | 12069369 |
| Molecular Formula | C18H17ClFNO8S2 |
| Molecular Weight | 493.92 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | 2-[9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carbonyl]oxyacetic acid |
| SMILES | CC1=C(C(=O)OCC(=O)O)C(c2c(F)cccc2Cl)C2=C(CS(=O)(=O)CCS2(=O)=O)N1 |
| InChI | InChI=1S/C18H17ClFNO8S2/c1-9-14(18(24)29-7-13(22)23)16(15-10(19)3-2-4-11(15)20)17-12(21-9)8-30(25,26)5-6-31(17,27)28/h2-4,16,21H,5-8H2,1H3,(H,22,23) |
| InChIKey | UZCWVFJNHYIOSQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.92 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |