C16H16BrNO4 — CID 120694172
(E)-2-[(6-bromo-2H-chromene-3-carbonyl)amino]hex-4-enoic acid (PubChem CID 120694172) has the molecular formula C16H16BrNO4 and a molecular weight of 366.21 g/mol. Its IUPAC name is (E)-2-[(6-bromo-2H-chromene-3-carbonyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(6-bromo-2H-chromene-3-carbonyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694172 |
| Molecular Formula | C16H16BrNO4 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | (E)-2-[(6-bromo-2H-chromene-3-carbonyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)C1=Cc2cc(Br)ccc2OC1)C(=O)O |
| InChI | InChI=1S/C16H16BrNO4/c1-2-3-4-13(16(20)21)18-15(19)11-7-10-8-12(17)5-6-14(10)22-9-11/h2-3,5-8,13H,4,9H2,1H3,(H,18,19)(H,20,21)/b3-2+ |
| InChIKey | FGLDMGXWPGAMIQ-NSCUHMNNSA-N |
| XLogP | 2.76 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|