C14H23N3O5 — CID 120694626
(2S)-4-methyl-2-[[2-[[1-(methylcarbamoyl)cyclopropanecarbonyl]amino]acetyl]amino]pentanoic acid (PubChem CID 120694626) has the molecular formula C14H23N3O5 and a molecular weight of 313.35 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-[[1-(methylcarbamoyl)cyclopropanecarbonyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-[[1-(methylcarbamoyl)cyclopropanecarbonyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120694626 |
| Molecular Formula | C14H23N3O5 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (2S)-4-methyl-2-[[2-[[1-(methylcarbamoyl)cyclopropanecarbonyl]amino]acetyl]amino]pentanoic acid |
| SMILES | CNC(=O)C1(C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O)CC1 |
| InChI | InChI=1S/C14H23N3O5/c1-8(2)6-9(11(19)20)17-10(18)7-16-13(22)14(4-5-14)12(21)15-3/h8-9H,4-7H2,1-3H3,(H,15,21)(H,16,22)(H,17,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | RKMSTPPYNSWLHP-VIFPVBQESA-N |
| XLogP | -0.76 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|