C18H23N3O5 — CID 120694664
(2S)-4-methyl-2-[[2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetyl]amino]pentanoic acid (PubChem CID 120694664) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120694664 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (2S)-4-methyl-2-[[2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)CN1Cc2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C18H23N3O5/c1-11(2)7-14(18(25)26)20-15(22)8-19-16(23)10-21-9-12-5-3-4-6-13(12)17(21)24/h3-6,11,14H,7-10H2,1-2H3,(H,19,23)(H,20,22)(H,25,26)/t14-/m0/s1 |
| InChIKey | UUJKFACWRFLRRA-AWEZNQCLSA-N |
| XLogP | 0.37 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |