C16H21BrN2O4 — CID 120694755
(2S)-2-[[2-[(3-bromo-2-methylbenzoyl)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120694755) has the molecular formula C16H21BrN2O4 and a molecular weight of 385.26 g/mol. Its IUPAC name is (2S)-2-[[2-[(3-bromo-2-methylbenzoyl)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[(3-bromo-2-methylbenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120694755 |
| Molecular Formula | C16H21BrN2O4 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (2S)-2-[[2-[(3-bromo-2-methylbenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1c(Br)cccc1C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C16H21BrN2O4/c1-9(2)7-13(16(22)23)19-14(20)8-18-15(21)11-5-4-6-12(17)10(11)3/h4-6,9,13H,7-8H2,1-3H3,(H,18,21)(H,19,20)(H,22,23)/t13-/m0/s1 |
| InChIKey | QYKVWLXKUGNUBT-ZDUSSCGKSA-N |
| XLogP | 2.10 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |