C17H21N3O5 — CID 120694771
(2S)-2-[[2-[[2-(4-cyanophenoxy)acetyl]amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120694771) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is (2S)-2-[[2-[[2-(4-cyanophenoxy)acetyl]amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[[2-(4-cyanophenoxy)acetyl]amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120694771 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2S)-2-[[2-[[2-(4-cyanophenoxy)acetyl]amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)COc1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C17H21N3O5/c1-11(2)7-14(17(23)24)20-15(21)9-19-16(22)10-25-13-5-3-12(8-18)4-6-13/h3-6,11,14H,7,9-10H2,1-2H3,(H,19,22)(H,20,21)(H,23,24)/t14-/m0/s1 |
| InChIKey | XDTAZSVUPHIHCE-AWEZNQCLSA-N |
| XLogP | 0.67 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |