C17H22N4O4 — CID 120695229
(2S)-2-[[2-[[2-(2H-indazol-3-yl)acetyl]amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120695229) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is (2S)-2-[[2-[[2-(2H-indazol-3-yl)acetyl]amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[[2-(2H-indazol-3-yl)acetyl]amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120695229 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2S)-2-[[2-[[2-(2H-indazol-3-yl)acetyl]amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)Cc1[nH]nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H22N4O4/c1-10(2)7-14(17(24)25)19-16(23)9-18-15(22)8-13-11-5-3-4-6-12(11)20-21-13/h3-6,10,14H,7-9H2,1-2H3,(H,18,22)(H,19,23)(H,20,21)(H,24,25)/t14-/m0/s1 |
| InChIKey | VOKAXWFRWVTVLY-AWEZNQCLSA-N |
| XLogP | 0.84 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |