C19H24N4O4 — CID 120696902
2-[4-[[2-[acetyl(2-phenylethyl)amino]acetyl]amino]pyrazol-1-yl]-2-methylpropanoic acid (PubChem CID 120696902) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[4-[[2-[acetyl(2-phenylethyl)amino]acetyl]amino]pyrazol-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[2-[acetyl(2-phenylethyl)amino]acetyl]amino]pyrazol-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120696902 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[4-[[2-[acetyl(2-phenylethyl)amino]acetyl]amino]pyrazol-1-yl]-2-methylpropanoic acid |
| SMILES | CC(=O)N(CCc1ccccc1)CC(=O)Nc1cnn(C(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C19H24N4O4/c1-14(24)22(10-9-15-7-5-4-6-8-15)13-17(25)21-16-11-20-23(12-16)19(2,3)18(26)27/h4-8,11-12H,9-10,13H2,1-3H3,(H,21,25)(H,26,27) |
| InChIKey | VHWXXWOABJGBAN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |