C19H22N4O3 — CID 120696950
2-[4-[[2-(1-ethylindol-3-yl)acetyl]amino]pyrazol-1-yl]-2-methylpropanoic acid (PubChem CID 120696950) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[4-[[2-(1-ethylindol-3-yl)acetyl]amino]pyrazol-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[2-(1-ethylindol-3-yl)acetyl]amino]pyrazol-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120696950 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[4-[[2-(1-ethylindol-3-yl)acetyl]amino]pyrazol-1-yl]-2-methylpropanoic acid |
| SMILES | CCn1cc(CC(=O)Nc2cnn(C(C)(C)C(=O)O)c2)c2ccccc21 |
| InChI | InChI=1S/C19H22N4O3/c1-4-22-11-13(15-7-5-6-8-16(15)22)9-17(24)21-14-10-20-23(12-14)19(2,3)18(25)26/h5-8,10-12H,4,9H2,1-3H3,(H,21,24)(H,25,26) |
| InChIKey | VIOUSXNUGTXLSU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |