C17H36O3Si — CID 12069736
[(3R)-3-(methoxymethoxy)-4-methylpent-4-enoxy]-tri(propan-2-yl)silane (PubChem CID 12069736) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is [(3R)-3-(methoxymethoxy)-4-methylpent-4-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(3R)-3-(methoxymethoxy)-4-methylpent-4-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 12069736 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | [(3R)-3-(methoxymethoxy)-4-methylpent-4-enoxy]-tri(propan-2-yl)silane |
| SMILES | C=C(C)[C@@H](CCO[Si](C(C)C)(C(C)C)C(C)C)OCOC |
| InChI | InChI=1S/C17H36O3Si/c1-13(2)17(19-12-18-9)10-11-20-21(14(3)4,15(5)6)16(7)8/h14-17H,1,10-12H2,2-9H3/t17-/m1/s1 |
| InChIKey | MLMMKUMXGRJHGM-QGZVFWFLSA-N |
| XLogP | 5.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|