C13H17N5O3 — CID 120697814
2-[4-[(5-ethyl-1H-pyrazole-3-carbonyl)amino]pyrazol-1-yl]-2-methylpropanoic acid (PubChem CID 120697814) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[4-[(5-ethyl-1H-pyrazole-3-carbonyl)amino]pyrazol-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(5-ethyl-1H-pyrazole-3-carbonyl)amino]pyrazol-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120697814 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[4-[(5-ethyl-1H-pyrazole-3-carbonyl)amino]pyrazol-1-yl]-2-methylpropanoic acid |
| SMILES | CCc1cc(C(=O)Nc2cnn(C(C)(C)C(=O)O)c2)n[nH]1 |
| InChI | InChI=1S/C13H17N5O3/c1-4-8-5-10(17-16-8)11(19)15-9-6-14-18(7-9)13(2,3)12(20)21/h5-7H,4H2,1-3H3,(H,15,19)(H,16,17)(H,20,21) |
| InChIKey | ZJDSPXARXDHXOH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |