C17H21N5O4 — CID 120698475
2-[4-[[[3-acetamido-3-(4-methylphenyl)propanoyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698475) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-[4-[[[3-acetamido-3-(4-methylphenyl)propanoyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[3-acetamido-3-(4-methylphenyl)propanoyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698475 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-[4-[[[3-acetamido-3-(4-methylphenyl)propanoyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | CC(=O)NC(CC(=O)NCc1cn(CC(=O)O)nn1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21N5O4/c1-11-3-5-13(6-4-11)15(19-12(2)23)7-16(24)18-8-14-9-22(21-20-14)10-17(25)26/h3-6,9,15H,7-8,10H2,1-2H3,(H,18,24)(H,19,23)(H,25,26) |
| InChIKey | BGQPZDPSTFLOSV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |