C15H18N2O4S — CID 120699168
6-(9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carbonyl)pyridine-2-carboxylic acid (PubChem CID 120699168) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 6-(9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carbonyl)pyridine-2-carboxylic acid.
| Compound Name | 6-(9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carbonyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 120699168 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 6-(9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carbonyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C(=O)N2CCSC3(CCOCC3)C2)n1 |
| InChI | InChI=1S/C15H18N2O4S/c18-13(11-2-1-3-12(16-11)14(19)20)17-6-9-22-15(10-17)4-7-21-8-5-15/h1-3H,4-10H2,(H,19,20) |
| InChIKey | HYSKNSXTVFEFKQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |