About 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid
3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid (PubChem CID 120699282) has the molecular formula C16H22N2O5
and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid |
| PubChem CID | 120699282 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid |
| SMILES | CCOC1CC(NC(=O)c2cccc(=O)n2C)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C16H22N2O5/c1-5-23-11-9-16(14(21)22,15(11,2)3)17-13(20)10-7-6-8-12(19)18(10)4/h6-8,11H,5,9H2,1-4H3,(H,17,20)(H,21,22) |
| InChIKey | NTCBXWZBKRNULP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid?
The IUPAC name of 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid (CID 120699282) is 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid?
The canonical SMILES for 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid is CCOC1CC(NC(=O)c2cccc(=O)n2C)(C(=O)O)C1(C)C.
What is the InChIKey of 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid?
The InChIKey is NTCBXWZBKRNULP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O5/c1-5-23-11-9-16(14(21)22,15(11,2)3)17-13(20)10-7-6-8-12(19)18(10)4/h6-8,11H,5,9H2,1-4H3,(H,17,20)(H,21,22).
What are the key properties of 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid?
3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid has a molecular weight of 322.36 g/mol, XLogP of 0.77, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,2-dimethyl-1-[(1-methyl-6-oxopyridine-2-carbonyl)amino]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 120699282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).