C20H28N2O5 — CID 120699333
3-ethoxy-2,2-dimethyl-1-[(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)amino]cyclobutane-1-carboxylic acid (PubChem CID 120699333) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 3-ethoxy-2,2-dimethyl-1-[(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)amino]cyclobutane-1-carboxylic acid.
| Compound Name | 3-ethoxy-2,2-dimethyl-1-[(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120699333 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-ethoxy-2,2-dimethyl-1-[(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)amino]cyclobutane-1-carboxylic acid |
| SMILES | CCOC1CC(NC(=O)c2cc3c([nH]c2=O)CCCCC3)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C20H28N2O5/c1-4-27-15-11-20(18(25)26,19(15,2)3)22-17(24)13-10-12-8-6-5-7-9-14(12)21-16(13)23/h10,15H,4-9,11H2,1-3H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | JPYWZGASXIPUHO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |