C19H26ClNO5 — CID 120699694
1-[4-(2-chlorophenoxy)butanoylamino]-3-ethoxy-2,2-dimethylcyclobutane-1-carboxylic acid (PubChem CID 120699694) has the molecular formula C19H26ClNO5 and a molecular weight of 383.87 g/mol. Its IUPAC name is 1-[4-(2-chlorophenoxy)butanoylamino]-3-ethoxy-2,2-dimethylcyclobutane-1-carboxylic acid.
| Compound Name | 1-[4-(2-chlorophenoxy)butanoylamino]-3-ethoxy-2,2-dimethylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120699694 |
| Molecular Formula | C19H26ClNO5 |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-[4-(2-chlorophenoxy)butanoylamino]-3-ethoxy-2,2-dimethylcyclobutane-1-carboxylic acid |
| SMILES | CCOC1CC(NC(=O)CCCOc2ccccc2Cl)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C19H26ClNO5/c1-4-25-15-12-19(17(23)24,18(15,2)3)21-16(22)10-7-11-26-14-9-6-5-8-13(14)20/h5-6,8-9,15H,4,7,10-12H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | XNRWHAILKLUTBN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|