C21H29NO6 — CID 120700207
3-ethoxy-1-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]-2,2-dimethylcyclobutane-1-carboxylic acid (PubChem CID 120700207) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is 3-ethoxy-1-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]-2,2-dimethylcyclobutane-1-carboxylic acid.
| Compound Name | 3-ethoxy-1-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]-2,2-dimethylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120700207 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-ethoxy-1-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]-2,2-dimethylcyclobutane-1-carboxylic acid |
| SMILES | C=CCc1ccc(OCC(=O)NC2(C(=O)O)CC(OCC)C2(C)C)c(OC)c1 |
| InChI | InChI=1S/C21H29NO6/c1-6-8-14-9-10-15(16(11-14)26-5)28-13-18(23)22-21(19(24)25)12-17(27-7-2)20(21,3)4/h6,9-11,17H,1,7-8,12-13H2,2-5H3,(H,22,23)(H,24,25) |
| InChIKey | TUFFXKIKPUFPOA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|