C21H25NO4 — CID 120701155
3-[3-(4-methoxyphenyl)butanoylamino]-2-methyl-2-phenylpropanoic acid (PubChem CID 120701155) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)butanoylamino]-2-methyl-2-phenylpropanoic acid.
| Compound Name | 3-[3-(4-methoxyphenyl)butanoylamino]-2-methyl-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 120701155 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)butanoylamino]-2-methyl-2-phenylpropanoic acid |
| SMILES | COc1ccc(C(C)CC(=O)NCC(C)(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO4/c1-15(16-9-11-18(26-3)12-10-16)13-19(23)22-14-21(2,20(24)25)17-7-5-4-6-8-17/h4-12,15H,13-14H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | NXGRJMMIRCIEPO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |