C18H21NO4 — CID 120701392
3-[(5-ethyl-4-methylfuran-2-carbonyl)amino]-2-methyl-2-phenylpropanoic acid (PubChem CID 120701392) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[(5-ethyl-4-methylfuran-2-carbonyl)amino]-2-methyl-2-phenylpropanoic acid.
| Compound Name | 3-[(5-ethyl-4-methylfuran-2-carbonyl)amino]-2-methyl-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 120701392 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-[(5-ethyl-4-methylfuran-2-carbonyl)amino]-2-methyl-2-phenylpropanoic acid |
| SMILES | CCc1oc(C(=O)NCC(C)(C(=O)O)c2ccccc2)cc1C |
| InChI | InChI=1S/C18H21NO4/c1-4-14-12(2)10-15(23-14)16(20)19-11-18(3,17(21)22)13-8-6-5-7-9-13/h5-10H,4,11H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | LSHHOPDTWGREDB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |