C9H14BrClN2O3S — CID 120706199
N-(2-aminoethyl)-2-bromo-4-methoxybenzenesulfonamide;hydrochloride (PubChem CID 120706199) has the molecular formula C9H14BrClN2O3S and a molecular weight of 345.65 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-bromo-4-methoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-bromo-4-methoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120706199 |
| Molecular Formula | C9H14BrClN2O3S |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | N-(2-aminoethyl)-2-bromo-4-methoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)NCCN)c(Br)c1.Cl |
| InChI | InChI=1S/C9H13BrN2O3S.ClH/c1-15-7-2-3-9(8(10)6-7)16(13,14)12-5-4-11;/h2-3,6,12H,4-5,11H2,1H3;1H |
| InChIKey | YEYNAZYAYWSCDE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |