C11H14BrFN2O2S — CID 120706601
1-(5-bromo-4-fluoro-2-methylphenyl)sulfonylpiperazine (PubChem CID 120706601) has the molecular formula C11H14BrFN2O2S and a molecular weight of 337.21 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-(5-bromo-4-fluoro-2-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 120706601 |
| Molecular Formula | C11H14BrFN2O2S |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methylphenyl)sulfonylpiperazine |
| SMILES | Cc1cc(F)c(Br)cc1S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C11H14BrFN2O2S/c1-8-6-10(13)9(12)7-11(8)18(16,17)15-4-2-14-3-5-15/h6-7,14H,2-5H2,1H3 |
| InChIKey | QWVFHZLXGWRPDA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |