About 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane
1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane (PubChem CID 120706967) has the molecular formula C10H18N4O2S
and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane |
| PubChem CID | 120706967 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane |
| SMILES | CCn1nccc1S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C10H18N4O2S/c1-2-14-10(4-6-12-14)17(15,16)13-8-3-5-11-7-9-13/h4,6,11H,2-3,5,7-9H2,1H3 |
| InChIKey | VHXPXAZXTXLUCQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane?
The IUPAC name of 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane (CID 120706967) is 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane.
What is the SMILES notation for 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane?
The canonical SMILES for 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane is CCn1nccc1S(=O)(=O)N1CCCNCC1.
What is the InChIKey of 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane?
The InChIKey is VHXPXAZXTXLUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2S/c1-2-14-10(4-6-12-14)17(15,16)13-8-3-5-11-7-9-13/h4,6,11H,2-3,5,7-9H2,1H3.
What are the key properties of 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane?
1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane has a molecular weight of 258.35 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylpyrazol-3-yl)sulfonyl-1,4-diazepane is sourced from PubChem (CID 120706967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).