C31H29NO3 — CID 12070727
(4S,5S)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-5-phenyl-1,3-dioxolan-2-one (PubChem CID 12070727) has the molecular formula C31H29NO3 and a molecular weight of 463.58 g/mol. Its IUPAC name is (4S,5S)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-5-phenyl-1,3-dioxolan-2-one.
| Compound Name | (4S,5S)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-5-phenyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 12070727 |
| Molecular Formula | C31H29NO3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (4S,5S)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-5-phenyl-1,3-dioxolan-2-one |
| SMILES | O=C1O[C@@H]([C@H](Cc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C31H29NO3/c33-31-34-29(27-19-11-4-12-20-27)30(35-31)28(21-24-13-5-1-6-14-24)32(22-25-15-7-2-8-16-25)23-26-17-9-3-10-18-26/h1-20,28-30H,21-23H2/t28-,29-,30-/m0/s1 |
| InChIKey | WQBQILJGEYECFU-DTXPUJKBSA-N |
| XLogP | 6.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |