About [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate
[(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate (PubChem CID 12070742) has the molecular formula C15H32O3Si
and a molecular weight of 288.50 g/mol. Its IUPAC name is [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate.
Molecular Properties
| Compound Name | [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate |
| PubChem CID | 12070742 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O3Si/c1-12(10-17-14(3)16)9-13(2)11-18-19(7,8)15(4,5)6/h12-13H,9-11H2,1-8H3/t12-,13+/m0/s1 |
| InChIKey | ILCNVWRNSJYHEX-QWHCGFSZSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate?
The IUPAC name of [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate (CID 12070742) is [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate.
What is the SMILES notation for [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate?
The canonical SMILES for [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate is CC(=O)OC[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate?
The InChIKey is ILCNVWRNSJYHEX-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H32O3Si/c1-12(10-17-14(3)16)9-13(2)11-18-19(7,8)15(4,5)6/h12-13H,9-11H2,1-8H3/t12-,13+/m0/s1.
What are the key properties of [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate?
[(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate has a molecular weight of 288.50 g/mol, XLogP of 4.23, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate is sourced from PubChem (CID 12070742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).